| Name | Ethyl 6,8-dichlorocaprylate |
| Synonyms | 6,8-DICHLOROCAPRYLATE Lipoic Acid Impurity 13 6,8-dichlorooctanoic acid Thioctic Acid Impurity 25 6,8-DICHLOROETHYLCAPRYLATE Ethyl 6,8-dichlorocaprylate Octanoic acid,6,8-dichloro- |
| CAS | 41443-60-1 1070-64-0 |
| EINECS | 435-080-1 |
| InChI | InChI=1/C10H18Cl2O2/c1-2-14-10(13)6-4-3-5-9(12)7-8-11/h9H,2-8H2,1H3 |
| Molecular Formula | C8H14Cl2O2 |
| Molar Mass | 213.1 |
| Density | 1.094g/cm3 |
| Boling Point | 288.5°C at 760 mmHg |
| Flash Point | 105.1°C |
| Vapor Presure | 0.00233mmHg at 25°C |
| Refractive Index | 1.455 |
| Physical and Chemical Properties | Chemical appearance: colorless to light yellow clear liquid; |
| Use | Used as an intermediate of vitamin drugs lipoic acid and thiooxamide |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| Raw Materials | Thionyl chlorideThionyl chloride 8-Chloro-6-Hydroxyoctanoic Acid Ethyl 6,8-dichlorooctanoate |
| Downstream Products | thioctic acid |
| acidity coefficient (pKa) | 4.73±0.10(Predicted) |
| WGK Germany | 2 |